cas: 32140-49-1 — see every product listed under this CAS number, including other names
3-Hydroxy-D-Phenylalanine, 95%+, 95%+ (CAS 32140-49-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ACG-1g |
| cas | 32140-49-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1782.80 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid (CAS 32140-49-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid. InChIKey: JZKXXXDKRQWDET-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | JZKXXXDKRQWDET-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)