CAS 32140-49-1 appears in our catalog under these names: D-m-Tyrosine, 96%, (2R)–2–Amino–3–(3–hydroxyphenyl)propanoic acid, H-D-meta-Tyr-OH, 3-Hydroxy-D-Phenylalanine, 95%+, 95%+, D-m-Tyrosine. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 500mg.
(2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid (CAS 32140-49-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid. InChIKey: JZKXXXDKRQWDET-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | JZKXXXDKRQWDET-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)