cas: 1086391-11-8 — see every product listed under this CAS number, including other names
3-IODO-1H-INDAZOLE-6-CARBOXYLIC ACID, 97% (CAS 1086391-11-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F857286-250MG |
| cas | 1086391-11-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 409.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-iodo-2H-indazole-6-carboxylic acid (CAS 1086391-11-8) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-2H-indazole-6-carboxylic acid. InChIKey: PTPFULUJKFPTCV-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-2H-indazole-6-carboxylic acid |
| InChIKey | PTPFULUJKFPTCV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C=C1C(=O)O)I |
Computed by PubChem (NCBI)