cas: 41070-12-6 — see every product listed under this CAS number, including other names
3-IODOCINNAMIC ACID, 98% (CAS 41070-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863443-250MG |
| cas | 41070-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1466.17 Pln | |
| Fluorochem | 10g | 2861.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(3-iodophenyl)prop-2-enoic acid (CAS 41070-12-6) is a chemical compound with the molecular formula C9H7IO2 and a molecular weight of 274.05 g/mol. IUPAC name: (E)-3-(3-iodophenyl)prop-2-enoic acid. InChIKey: XQOFQTFBKOHMCW-SNAWJCMRSA-N.
| Molecular formula | C9H7IO2 |
|---|---|
| Molecular weight | 274.05 g/mol |
| IUPAC name | (E)-3-(3-iodophenyl)prop-2-enoic acid |
| InChIKey | XQOFQTFBKOHMCW-SNAWJCMRSA-N |
| SMILES | C1=CC(=CC(=C1)I)/C=C/C(=O)O |
Computed by PubChem (NCBI)