cas: 908295-26-1 — see every product listed under this CAS number, including other names
3-Iodo-5-nitro-1H-indole, 95%, 95% (CAS 908295-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IGB8-100mg |
| cas | 908295-26-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2267.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-iodo-5-nitro-1H-indole (CAS 908295-26-1) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-5-nitro-1H-indole. InChIKey: YRJOAOLHLHTRDC-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-5-nitro-1H-indole |
| InChIKey | YRJOAOLHLHTRDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CN2)I |
Computed by PubChem (NCBI)