3-Iodo-6-nitro-1H-indole, 97%
cas: 1360963-23-0 — see every product listed under this CAS number, including other names
3-Iodo-6-nitro-1H-indole, 97% (CAS 1360963-23-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 10g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A423644-250mg |
| cas | 1360963-23-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 577.78 Pln | |
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 500mg | 575.86 Pln | |
| Fluorochem | 1g | 830.98 Pln | |
| Fluorochem | 5g | 2580.36 Pln | |
| Fluorochem | 10g | 4251.65 Pln | |
| Fluorochem | 25g | 8437.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-iodo-6-nitro-1H-indole (CAS 1360963-23-0) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-6-nitro-1H-indole. InChIKey: VWYMWFCKFDGAFF-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-6-nitro-1H-indole |
| InChIKey | VWYMWFCKFDGAFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=C2I |
Computed by PubChem (NCBI)
Synonyms:
3-iodo-6-nitro-1H-indole