cas: 1060816-80-9 — see every product listed under this CAS number, including other names
3-Iodo-7-azaindole-5-carboxylic acid, 95%, 95% (CAS 1060816-80-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HARY-100mg |
| cas | 1060816-80-9 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 1125.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-iodo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid (CAS 1060816-80-9) is a chemical compound with the molecular formula C8H5IN2O2 and a molecular weight of 288.04 g/mol. IUPAC name: 3-iodo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid. InChIKey: FNQBSSMJOSBURI-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O2 |
|---|---|
| Molecular weight | 288.04 g/mol |
| IUPAC name | 3-iodo-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| InChIKey | FNQBSSMJOSBURI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)I)C(=O)O |
Computed by PubChem (NCBI)