cas: 92241-87-7 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitrobenzamide 98% (CAS 92241-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A896438-1g |
| cas | 92241-87-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 459.38 Pln | |
| Ambeed | 10g | 748.62 Pln | |
| Ambeed | 25g | 1432.81 Pln | |
| Ambeed | 100g | 5204.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A896438 |
3-methoxy-4-nitrobenzamide (CAS 92241-87-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 3-methoxy-4-nitrobenzamide. InChIKey: HBEDVMJPLSCWPI-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 3-methoxy-4-nitrobenzamide |
| InChIKey | HBEDVMJPLSCWPI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)