cas: 5081-36-7 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitrobenzoic acid 98% (CAS 5081-36-7) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188777-1000g |
| cas | 5081-36-7 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2083.62 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A188777 |
3-methoxy-4-nitrobenzoic acid (CAS 5081-36-7) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 3-methoxy-4-nitrobenzoic acid. InChIKey: PWURRRRGLCVBMX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-methoxy-4-nitrobenzoic acid |
| InChIKey | PWURRRRGLCVBMX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)