CAS 5081-36-7 appears in our catalog under these names: 3–Methoxy–4–nitrobenzoic acid, 3-Methoxy-4-nitrobenzoic acid, 98+% , 3-Methoxy-4-nitrobenzoic acid, 3-Methoxy-4-nitrobenzoic Acid, >98.0%(GC)(T), 3-Methoxy-4-nitrobenzoic acid 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 0,25kg, 0,5kg, 1kg, 1000g, 1g.
3-methoxy-4-nitrobenzoic acid (CAS 5081-36-7) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 3-methoxy-4-nitrobenzoic acid. InChIKey: PWURRRRGLCVBMX-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3-methoxy-4-nitrobenzoic acid |
| InChIKey | PWURRRRGLCVBMX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)