cas: 7245-02-5 — see every product listed under this CAS number, including other names
3-Methoxyflavone 99% (CAS 7245-02-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A451328-250mg |
| cas | 7245-02-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1277.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A451328 |
3-methoxy-2-phenylchromen-4-one (CAS 7245-02-5) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 3-methoxy-2-phenylchromen-4-one. InChIKey: ZAIANDVQAMEDFL-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 3-methoxy-2-phenylchromen-4-one |
| InChIKey | ZAIANDVQAMEDFL-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC=CC=C2C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)