cas: 7245-02-5 — see every product listed under this CAS number, including other names
3-Methoxyflavone, 98% (CAS 7245-02-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624272-50MG |
| cas | 7245-02-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 320.74 Pln | |
| Fluorochem | 100mg | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxy-2-phenylchromen-4-one (CAS 7245-02-5) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 3-methoxy-2-phenylchromen-4-one. InChIKey: ZAIANDVQAMEDFL-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 3-methoxy-2-phenylchromen-4-one |
| InChIKey | ZAIANDVQAMEDFL-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC=CC=C2C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)