cas: 7245-02-5 — see every product listed under this CAS number, including other names
3-Methoxyflavone, 99%, 99% (CAS 7245-02-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDTM-250mg |
| cas | 7245-02-5 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-2-phenylchromen-4-one (CAS 7245-02-5) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 3-methoxy-2-phenylchromen-4-one. InChIKey: ZAIANDVQAMEDFL-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 3-methoxy-2-phenylchromen-4-one |
| InChIKey | ZAIANDVQAMEDFL-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC=CC=C2C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)