3-Methyl-N,N-diphenylaniline, 97%
cas: 4316-54-5 — see every product listed under this CAS number, including other names
3-Methyl-N,N-diphenylaniline, 97% (CAS 4316-54-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A620990-100mg |
| cas | 4316-54-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 793.12 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 853.06 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 842.00 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 810.15 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-methyl-N,N-diphenylaniline (CAS 4316-54-5) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: 3-methyl-N,N-diphenylaniline. InChIKey: FHMZRXAOGIFMFL-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 3-methyl-N,N-diphenylaniline |
| InChIKey | FHMZRXAOGIFMFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)