CAS 4316-54-5 appears in our catalog under these names: 3–Methyl–N,N–diphenylaniline, 3-Methyl-N,N-diphenylaniline 97%, 3-Methyl-N,N-diphenylaniline, 97%, 97%, 3-Methyl-N,N-diphenylaniline, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
3-methyl-N,N-diphenylaniline (CAS 4316-54-5) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: 3-methyl-N,N-diphenylaniline. InChIKey: FHMZRXAOGIFMFL-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 3-methyl-N,N-diphenylaniline |
| InChIKey | FHMZRXAOGIFMFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)