CAS 109975-61-3 is the registry number for 4–(1,1–diphenylethyl)pyridine. Offered by: GLPBio. Available pack sizes: 250mg, 500mg.
4-(1,1-diphenylethyl)pyridine (CAS 109975-61-3) is a chemical compound with the molecular formula C19H17N and a molecular weight of 259.3 g/mol. IUPAC name: 4-(1,1-diphenylethyl)pyridine. InChIKey: CJQGILPQYWJLHC-UHFFFAOYSA-N.
| Molecular formula | C19H17N |
|---|---|
| Molecular weight | 259.3 g/mol |
| IUPAC name | 4-(1,1-diphenylethyl)pyridine |
| InChIKey | CJQGILPQYWJLHC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)