3-Methylphthalic anhydride, 98%, 98%
cas: 4792-30-7 — see every product listed under this CAS number, including other names
3-Methylphthalic anhydride, 98%, 98% (CAS 4792-30-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11454X-250mg |
| cas | 4792-30-7 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 25g | 1144.40 Pln | |
| Chemat | 100g | 3400.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-benzofuran-1,3-dione (CAS 4792-30-7) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 4-methyl-2-benzofuran-1,3-dione. InChIKey: TWWAWPHAOPTQEU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 4-methyl-2-benzofuran-1,3-dione |
| InChIKey | TWWAWPHAOPTQEU-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
3-Methylphthalic anhydride, 1,3-Isobenzofurandione, 4-methyl-, Phthalic anhydride, 3-methyl-, 2,3-Toluenedicarboxylic anhydride, 4-Methyl-1,3-isobenzofurandione, 4-methylisobenzofuran-1,3-dione, 4-Methyl-2-benzofuran-1,3-dione, 3-Methyl phthalic anhydride, 4-methyl-1,3-dihydro-2-benzofuran-1,3-dione, 4-methyl-isobenzofuran-1,3-dione