Products 166599-84-4
CAS 166599-84-4 appears in our catalog under these names: 4-Benzofurancarboxylic Acid, Benzofuran–4–carboxylic acid, Benzofuran-4-carboxylic acid, 95%, Benzofuran-4-carboxylic acid 95%, Benzofuran-4-carboxylic acid, 97%. Offered by: Biosynth, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 1g, 250mg.
1-benzofuran-4-carboxylic acid (CAS 166599-84-4) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-4-carboxylic acid. InChIKey: WFAPIZKLEVLUMX-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-4-carboxylic acid |
| InChIKey | WFAPIZKLEVLUMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=COC2=C1)C(=O)O |
Computed by PubChem (NCBI)