Products 19438-61-0
CAS 19438-61-0 appears in our catalog under these names: 4-Methylphthalic anhydride, 95%, 4–methylphthalic anhydride, 4-Methylphthalic Anhydride, >98.0%(GC)(T), 4-Methylphthalic anhydride, 96%, 4-Methylphthalic anhydride 98%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 500g, 5g, 100g, 1g.
5-methyl-2-benzofuran-1,3-dione (CAS 19438-61-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-methyl-2-benzofuran-1,3-dione. InChIKey: ZOXBWJMCXHTKNU-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-methyl-2-benzofuran-1,3-dione |
| InChIKey | ZOXBWJMCXHTKNU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
4-Methylphthalic anhydride, 5-Methyl-2-benzofuran-1,3-dione, 1,3-Isobenzofurandione, 5-methyl-, Phthalic anhydride, 4-methyl-, 4-methylphthalic acid anhydride, Phthalic anhydride, 4methyl, 5Methylisobenzofuran1,3dione, 4Methylphthalic acid anhydride, 1,3Isobenzofurandione, 5methyl, ZOXBWJMCXHTKNU-UHFFFAOYSA-N