CAS 5693-27-6 appears in our catalog under these names: 1H-2-Benzopyran-1,4(3h)-dione, 95%, Isochroman-1,4-dione, 95%, Isochroman–1,4–dione, 1H-2-Benzopyran-1,4(3H)-dione, Isochroman-1,4-dione. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg.
Isochromene-1,4-dione (CAS 5693-27-6) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: isochromene-1,4-dione. InChIKey: FRPUZPKXFMJGKF-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | isochromene-1,4-dione |
| InChIKey | FRPUZPKXFMJGKF-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2C(=O)O1 |
Computed by PubChem (NCBI)