Products 26537-68-8
CAS 26537-68-8 appears in our catalog under these names: 1-Benzofuran-3-carboxylic acid, 95%, Benzofuran–3–carboxylic acid, Benzofuran-3-carboxylic acid, Benzofuran-3-carboxylic acid 95%, Benzofuran-3-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g, 100mg, 25g, 500mg, 10g.
1-benzofuran-3-carboxylic acid (CAS 26537-68-8) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 1-benzofuran-3-carboxylic acid. InChIKey: BENJFDPHDCGUAQ-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 1-benzofuran-3-carboxylic acid |
| InChIKey | BENJFDPHDCGUAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)