CAS 1215373-23-1 appears in our catalog under these names: 7-Hydroxy Coumarin-d5, 7-Hydroxy Coumarin-d5, >95% (HPLC), Umbelliferone-d5, 98.0%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 2.5 mg.
3,4,5,6,8-pentadeuterio-7-hydroxychromen-2-one (CAS 1215373-23-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 167.17 g/mol. IUPAC name: 3,4,5,6,8-pentadeuterio-7-hydroxychromen-2-one. InChIKey: ORHBXUUXSCNDEV-RALIUCGRSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 167.17 g/mol |
| IUPAC name | 3,4,5,6,8-pentadeuterio-7-hydroxychromen-2-one |
| InChIKey | ORHBXUUXSCNDEV-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=O)O2)[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)