3-Nitro-1H-pyrazole-5-carboxylic acid, 97%, 97%
cas: 925646-13-5 — see every product listed under this CAS number, including other names
3-Nitro-1H-pyrazole-5-carboxylic acid, 97%, 97% (CAS 925646-13-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H224-250mg |
| cas | 925646-13-5 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 251.60 Pln | |
| Chemat | 10g | 395.60 Pln | |
| Chemat | 25g | 731.60 Pln | |
| Chemat | 100g | 2459.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1H-pyrazole-3-carboxylic acid (CAS 925646-13-5) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: HKYHBMLIEAMWRO-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
5-Nitro-1H-pyrazole-3-carboxylic acid, 5-Nitro-3-pyrazolecarboxylic acid, 3-nitro-1H-pyrazole-5-carboxylic acid, 5-nitropyrazole-3-carboxylic acid, 5-Nitro-3-pyrazol carboxylic acid, 5-nitro-1H-pyrazol-3-carboxylic acid, Pyrazole-3-carboxylic acid, 5-nitro-, 3-nitro-1H-pyrazole-5-carboxylic acid(SALTDATA: FREE), 5-Nitro-2H-pyrazole-3-carboxylic acid, 5-nitro-3-pyrazole carboxylic acid