CAS 925646-13-5 appears in our catalog under these names: 3-Nitro-1H-pyrazole-5-carboxylic acid 97%, 3-Nitro-1H-pyrazole-5-carboxylic acid, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
5-nitro-1H-pyrazole-3-carboxylic acid (CAS 925646-13-5) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: HKYHBMLIEAMWRO-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)