CAS 2854-59-3 is the registry number for 4-Hydroxy-5-nitropyridazin-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
5-nitro-1,2-dihydropyridazine-3,4-dione (CAS 2854-59-3) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1,2-dihydropyridazine-3,4-dione. InChIKey: ZRZQHOGQSIIRGL-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1,2-dihydropyridazine-3,4-dione |
| InChIKey | ZRZQHOGQSIIRGL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)C(=O)NN1)[N+](=O)[O-] |
Computed by PubChem (NCBI)