CAS 5334-40-7 appears in our catalog under these names: 4–Nitro–3–pyrazolecarboxylic acid, 4-Nitro-1H-pyrazole-3-carboxylic acid, 98% , 4-Nitro-1H-pyrazole-3-carboxylic acid, 4-Nitro-1H-pyrazole-3-carboxylic acid 98%, 4-Nitro-1H-pyrazole-3-carboxylic acid, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100g, 25g, 10g, 1g, 5g, 500g, 1000g, 1kg.
4-nitro-1H-pyrazole-5-carboxylic acid (CAS 5334-40-7) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 4-nitro-1H-pyrazole-5-carboxylic acid. InChIKey: ZMAXXOYJWZZQBK-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 4-nitro-1H-pyrazole-5-carboxylic acid |
| InChIKey | ZMAXXOYJWZZQBK-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)