CAS 198348-89-9 appears in our catalog under these names: 5-Nitro-3-pyrazolecarboxylic acid, 5-Nitro-3-pyrazolecarboxylic acid 98%, 5-Nitro-3-pyrazolecarboxylic acid, 98%, 98%, 5-Nitro-1H-pyrazole-3-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1000g, 1g, 25g, 100g, 500g.
5-nitro-1H-pyrazole-3-carboxylic acid (CAS 198348-89-9) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: HKYHBMLIEAMWRO-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)