CAS 351990-51-7 appears in our catalog under these names: 5-Nitro-1h-imidazole-2-carboxylic acid, 95%, 5-Nitro-1H-imidazole-2-carboxylic acid, 5–Nitro–1H–imidazole–2–carboxylic acid, 5-Nitro-1H-imidazole-2-carboxylic acid 95%, 1H-Imidazole-2-carboxylic acid, 5-nitro-, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, on request, 10g.
5-nitro-1H-imidazole-2-carboxylic acid (CAS 351990-51-7) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-imidazole-2-carboxylic acid. InChIKey: LNPSXTPPQBEISL-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-imidazole-2-carboxylic acid |
| InChIKey | LNPSXTPPQBEISL-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)