cas: 15590-90-6 — see every product listed under this CAS number, including other names
3-Nitro-1H-pyridin-4-one 98% (CAS 15590-90-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A788395-5g |
| cas | 15590-90-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 453.81 Pln | |
| Ambeed | 500g | 1583.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A788395 |
3-nitro-1H-pyridin-4-one (CAS 15590-90-6) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 3-nitro-1H-pyridin-4-one. InChIKey: YUWOLBZMQDGRFV-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 3-nitro-1H-pyridin-4-one |
| InChIKey | YUWOLBZMQDGRFV-UHFFFAOYSA-N |
| SMILES | C1=CNC=C(C1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)