cas: 121-52-8 — see every product listed under this CAS number, including other names
3-Nitrobenzenesulfonamide, 98%, 98% (CAS 121-52-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187A0-1g |
| cas | 121-52-8 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 107.60 Pln | |
| Chemat | 100g | 246.80 Pln | |
| Chemat | 500g | 1041.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-nitrobenzenesulfonamide (CAS 121-52-8) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 3-nitrobenzenesulfonamide. InChIKey: TXTQURPQLVHJRE-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 3-nitrobenzenesulfonamide |
| InChIKey | TXTQURPQLVHJRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)