cas: 618-94-0 — see every product listed under this CAS number, including other names
3-Nitrobenzhydrazide, 95% (CAS 618-94-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018900-1G |
| cas | 618-94-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 653.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
3-nitrobenzohydrazide (CAS 618-94-0) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-nitrobenzohydrazide. InChIKey: NQEWXLVDAVTOHM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-nitrobenzohydrazide |
| InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)