CAS 618-94-0 appears in our catalog under these names: 3-Nitrobenzoylhydrazine, 98%, 3–Nitrobenzhydrazide, 3-Nitrobenzhydrazide, 98+% , 3-Nitrobenzhydrazide, >98.0%(T), 3-Nitrobenzhydrazide. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 250g, 500g, 1000g, 1kg.
3-nitrobenzohydrazide (CAS 618-94-0) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 3-nitrobenzohydrazide. InChIKey: NQEWXLVDAVTOHM-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-nitrobenzohydrazide |
| InChIKey | NQEWXLVDAVTOHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)