cas: 586954-09-8 — see every product listed under this CAS number, including other names
3-O-Methyldopa-d3 (CAS 586954-09-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | TMIH-0049-1mg |
| cas | 586954-09-8 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 2265.51 Pln | |
| TargetMol | 5mg | 6462.48 Pln | |
| TargetMol | 10mg | 8587.24 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 33 days |
(2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid (CAS 586954-09-8) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 214.23 g/mol. IUPAC name: (2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: PFDUUKDQEHURQC-LNEZGBMJSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid |
| InChIKey | PFDUUKDQEHURQC-LNEZGBMJSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)