Products 1219173-95-1
CAS 1219173-95-1 appears in our catalog under these names: (rac)–3–O–Methyl DOPA–d3, rac 3-O-Methyl DOPA-d3, >95% (HPLC), (rac)-3-O-Methyl DOPA-d3, 98.73%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 1mg, 10mg, 5 mg, 1 mg.
2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid (CAS 1219173-95-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 214.23 g/mol. IUPAC name: 2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: PFDUUKDQEHURQC-FIBGUPNXSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | 2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid |
| InChIKey | PFDUUKDQEHURQC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)CC(C(=O)O)N)O |
Computed by PubChem (NCBI)