CAS 1259947-39-1 is the registry number for (R)-3-O-Methyldopa-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2R)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid (CAS 1259947-39-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 214.23 g/mol. IUPAC name: (2R)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: PFDUUKDQEHURQC-ISLPBHIQSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (2R)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid |
| InChIKey | PFDUUKDQEHURQC-ISLPBHIQSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C[C@H](C(=O)O)N)O |
Computed by PubChem (NCBI)