CAS 586954-09-8 appears in our catalog under these names: Levodopa EP Impurity C-d3 (S-isomer) (L-3-O-Methyldopa-d3), L-3-(4-Hydroxy-3-methoxy-d3-phenyl)alanine, >95% (HPLC), 3–O–Methyldopa D3, 3-O-Methyldopa-d3, 3-o-Methyldopa d3. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: on request, 5mg, 1mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid (CAS 586954-09-8) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 214.23 g/mol. IUPAC name: (2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid. InChIKey: PFDUUKDQEHURQC-LNEZGBMJSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 214.23 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-hydroxy-3-(trideuteriomethoxy)phenyl]propanoic acid |
| InChIKey | PFDUUKDQEHURQC-LNEZGBMJSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C[C@@H](C(=O)O)N)O |
Computed by PubChem (NCBI)