cas: 172876-96-9 — see every product listed under this CAS number, including other names
3-Oxo-1,2-benziodoxole-1-(3H)-carbonitrile, 95%, 95% (CAS 172876-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQQA-100mg |
| cas | 172876-96-9 |
| size | 100mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Chemat | 5g | 904.40 Pln | |
| Chemat | 10g | 1749.20 Pln | |
| Chemat | 25g | 3146.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-oxo-1lambda3,2-benziodoxole-1-carbonitrile (CAS 172876-96-9) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 3-oxo-1lambda3,2-benziodoxole-1-carbonitrile. InChIKey: AOTJNSUBRSAHHW-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 3-oxo-1lambda3,2-benziodoxole-1-carbonitrile |
| InChIKey | AOTJNSUBRSAHHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OI2C#N |
Computed by PubChem (NCBI)