CAS 20919-42-0 appears in our catalog under these names: N-Iodophthalimide, 95%, 2–Iodoisoindoline–1,3–dione, N-Iodophthalimide, >98.0%(T), 2-Iodoisoindoline-1,3-dione 96%, N-Iodophthalimide, 96%, 96%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g.
2-iodoisoindole-1,3-dione (CAS 20919-42-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-iodoisoindole-1,3-dione. InChIKey: ISZGNNPTDCJIIS-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 2-iodoisoindole-1,3-dione |
| InChIKey | ISZGNNPTDCJIIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)I |
Computed by PubChem (NCBI)