Products 58123-75-4
CAS 58123-75-4 is the registry number for 4-Cyano-3-iodobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-cyano-3-iodobenzoic acid (CAS 58123-75-4) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-cyano-3-iodobenzoic acid. InChIKey: MAPYTADMDDOORV-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 4-cyano-3-iodobenzoic acid |
| InChIKey | MAPYTADMDDOORV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)I)C#N |
Computed by PubChem (NCBI)