CAS 185050-32-2 is the registry number for 2-Cyano-5-iodobenzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyano-5-iodobenzoic acid (CAS 185050-32-2) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-cyano-5-iodobenzoic acid. InChIKey: GURKJLQOEBNLCE-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 2-cyano-5-iodobenzoic acid |
| InChIKey | GURKJLQOEBNLCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C(=O)O)C#N |
Computed by PubChem (NCBI)