Products 185050-32-2

CAS 185050-32-2 is the registry number for 2-Cyano-5-iodobenzoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-cyano-5-iodobenzoic acid (CAS 185050-32-2) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 2-cyano-5-iodobenzoic acid. InChIKey: GURKJLQOEBNLCE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4INO2
Molecular weight273.03 g/mol
IUPAC name2-cyano-5-iodobenzoic acid
InChIKeyGURKJLQOEBNLCE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1I)C(=O)O)C#N

Computed by PubChem (NCBI)