CAS 20780-78-3 appears in our catalog under these names: 7-Iodo-indole-2,3-dione, 95%, 7-Iodoindoline-2,3-dione, 98%, 7–Iodoisatin, 7-Iodoindoline-2,3-dione, 98%+, 98%+, 7-Iodoindoline-2,3-dione. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 200mg.
7-iodo-1H-indole-2,3-dione (CAS 20780-78-3) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 7-iodo-1H-indole-2,3-dione. InChIKey: RLGIFVDILDEIHL-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 7-iodo-1H-indole-2,3-dione |
| InChIKey | RLGIFVDILDEIHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)NC(=O)C2=O |
Computed by PubChem (NCBI)