CAS 20780-75-0 appears in our catalog under these names: 4-Iodoindoline-2,3-dione, 95%, 4-Iodoisatin, 4-Iodoindoline-2,3-dione 98%, 4-Iodoindoline-2,3-dione, 98%, 98%, 4-Iodoindoline-2,3-dione, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2g, 25g, 10g.
4-iodo-1H-indole-2,3-dione (CAS 20780-75-0) is a chemical compound with the molecular formula C8H4INO2 and a molecular weight of 273.03 g/mol. IUPAC name: 4-iodo-1H-indole-2,3-dione. InChIKey: NYWOXCHAPWQNFC-UHFFFAOYSA-N.
| Molecular formula | C8H4INO2 |
|---|---|
| Molecular weight | 273.03 g/mol |
| IUPAC name | 4-iodo-1H-indole-2,3-dione |
| InChIKey | NYWOXCHAPWQNFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)