cas: 959-66-0 — see every product listed under this CAS number, including other names
3-Oxo-N,3-diphenylpropanamide, 98% (CAS 959-66-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226655-5G |
| cas | 959-66-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 502.97 Pln | |
| Fluorochem | 100g | 1846.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-oxo-N,3-diphenylpropanamide (CAS 959-66-0) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 3-oxo-N,3-diphenylpropanamide. InChIKey: XRZDIHADHZSFBB-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 3-oxo-N,3-diphenylpropanamide |
| InChIKey | XRZDIHADHZSFBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)