CAS 95093-95-1 appears in our catalog under these names: (S)-(+)-4-(2,3-Epoxypropoxy)carbazole, 95%, (S)-3-(9H-Carbazol-4-yloxy)-1,2-epoxypropane, 95-<97%, (S)-3-(9H-Carbazol-4-yloxy)-1,2-epoxypropane, ≥97-<99%, (S)-(+)-4-(2,3-Epoxypropoxy)carbazole, (S)-4-(Oxiran-2-ylmethoxy)-9H-carbazole, 97%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 2,5g, 5g, 10g, 25g, 50mg.
4-[[(2S)-oxiran-2-yl]methoxy]-9H-carbazole (CAS 95093-95-1) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 4-[[(2S)-oxiran-2-yl]methoxy]-9H-carbazole. InChIKey: SVWKIGRDISDRLO-JTQLQIEISA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-[[(2S)-oxiran-2-yl]methoxy]-9H-carbazole |
| InChIKey | SVWKIGRDISDRLO-JTQLQIEISA-N |
| SMILES | C1[C@H](O1)COC2=CC=CC3=C2C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)