CAS 63208-65-1 is the registry number for 4-Benzyl-2H-1,4-benzoxazin-3-one, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-benzyl-1,4-benzoxazin-3-one (CAS 63208-65-1) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 4-benzyl-1,4-benzoxazin-3-one. InChIKey: VHTLTHHJLPLDOK-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-benzyl-1,4-benzoxazin-3-one |
| InChIKey | VHTLTHHJLPLDOK-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=CC=CC=C2O1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)