CAS 95093-96-2 appears in our catalog under these names: (R)-4-(Oxiran-2-ylmethoxy)-9H-carbazole, 97%, (R)-(-)-4-(2,3-Epoxypropoxy)carbazole, 95%, (R)-(-)-4-(2,3-Epoxypropoxy)carbazole. Offered by: AmBeed, Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 50mg, 500mg, 1000mg.
4-[[(2R)-oxiran-2-yl]methoxy]-9H-carbazole (CAS 95093-96-2) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 4-[[(2R)-oxiran-2-yl]methoxy]-9H-carbazole. InChIKey: SVWKIGRDISDRLO-SNVBAGLBSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-[[(2R)-oxiran-2-yl]methoxy]-9H-carbazole |
| InChIKey | SVWKIGRDISDRLO-SNVBAGLBSA-N |
| SMILES | C1[C@@H](O1)COC2=CC=CC3=C2C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)