Products 26060-56-0
CAS 26060-56-0 appears in our catalog under these names: Acetophenone o-benzoyloxime, 95%, Acetophenone O–Benzoyloxime, Acetophenone O-Benzoyloxime, >98.0%(HPLC)(N), 1-Phenylethanone O-benzoyloxime, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg.
[(E)-1-phenylethylideneamino] benzoate (CAS 26060-56-0) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: [(E)-1-phenylethylideneamino] benzoate. InChIKey: KLJLQTJYNGGTIU-FOWTUZBSSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | [(E)-1-phenylethylideneamino] benzoate |
| InChIKey | KLJLQTJYNGGTIU-FOWTUZBSSA-N |
| SMILES | C/C(=N\OC(=O)C1=CC=CC=C1)/C2=CC=CC=C2 |
Computed by PubChem (NCBI)