CAS 2222512-09-4 is the registry number for 5-(Benzyloxy)-2,3-dihydroisoindol-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-phenylmethoxy-2,3-dihydroisoindol-1-one (CAS 2222512-09-4) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 5-phenylmethoxy-2,3-dihydroisoindol-1-one. InChIKey: JTFGOYIXFDBGNY-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 5-phenylmethoxy-2,3-dihydroisoindol-1-one |
| InChIKey | JTFGOYIXFDBGNY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)OCC3=CC=CC=C3)C(=O)N1 |
Computed by PubChem (NCBI)