cas: 92961-15-4 — see every product listed under this CAS number, including other names
3-PHENYLIMIDAZO[1,2-A]PYRIDINE, 97%, 97% (CAS 92961-15-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHER-100mg |
| cas | 92961-15-4 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1427.60 Pln | |
| Chemat | 1g | 4547.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-phenylimidazo[1,2-a]pyridine (CAS 92961-15-4) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 3-phenylimidazo[1,2-a]pyridine. InChIKey: AFWDAKKJDBULCR-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-phenylimidazo[1,2-a]pyridine |
| InChIKey | AFWDAKKJDBULCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C3N2C=CC=C3 |
Computed by PubChem (NCBI)