3-Phenoxymandelic acid, 98%
cas: 66637-86-3 — see every product listed under this CAS number, including other names
3-Phenoxymandelic acid, 98% (CAS 66637-86-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12EWUA-100mg |
| cas | 66637-86-3 |
| size | 100mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 731.60 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2354.00 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 586.27 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-2-(3-phenoxyphenyl)acetic acid (CAS 66637-86-3) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-hydroxy-2-(3-phenoxyphenyl)acetic acid. InChIKey: FPUCYPXKIFVDSD-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-hydroxy-2-(3-phenoxyphenyl)acetic acid |
| InChIKey | FPUCYPXKIFVDSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C(=O)O)O |
Computed by PubChem (NCBI)